C28H37N3O4Si — CID 11409584
1-(2-ethoxy-5-trimethylsilylphenyl)-3-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]urea (PubChem CID 11409584) has the molecular formula C28H37N3O4Si and a molecular weight of 507.71 g/mol. Its IUPAC name is 1-(2-ethoxy-5-trimethylsilylphenyl)-3-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]urea.
| Compound Name | 1-(2-ethoxy-5-trimethylsilylphenyl)-3-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 11409584 |
| Molecular Formula | C28H37N3O4Si |
| Molecular Weight | 507.71 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 1-(2-ethoxy-5-trimethylsilylphenyl)-3-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]urea |
| SMILES | CCOc1ccc([Si](C)(C)C)cc1NC(=O)Nc1ccc(OCCN2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C28H37N3O4Si/c1-5-34-27-12-10-21(36(2,3)4)20-25(27)30-28(32)29-24-11-13-26(23-9-7-6-8-22(23)24)35-19-16-31-14-17-33-18-15-31/h6-13,20H,5,14-19H2,1-4H3,(H2,29,30,32) |
| InChIKey | MMLLPXCDOUZMBK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.71 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|