C32H34N2O4 — CID 70834420
3-(2-ethoxy-5-methylphenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide (PubChem CID 70834420) has the molecular formula C32H34N2O4 and a molecular weight of 510.63 g/mol. Its IUPAC name is 3-(2-ethoxy-5-methylphenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide.
| Compound Name | 3-(2-ethoxy-5-methylphenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 70834420 |
| Molecular Formula | C32H34N2O4 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 3-(2-ethoxy-5-methylphenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide |
| SMILES | CCOc1ccc(C)cc1-c1cccc(C(=O)Nc2ccc(OCCN3CCOCC3)c3ccccc23)c1 |
| InChI | InChI=1S/C32H34N2O4/c1-3-37-31-13-11-23(2)21-28(31)24-7-6-8-25(22-24)32(35)33-29-12-14-30(27-10-5-4-9-26(27)29)38-20-17-34-15-18-36-19-16-34/h4-14,21-22H,3,15-20H2,1-2H3,(H,33,35) |
| InChIKey | BHZAWPHLZZZFQA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |