C31H30N2O3 — CID 59553458
3-(4-ethenylphenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide (PubChem CID 59553458) has the molecular formula C31H30N2O3 and a molecular weight of 478.59 g/mol. Its IUPAC name is 3-(4-ethenylphenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide.
| Compound Name | 3-(4-ethenylphenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 59553458 |
| Molecular Formula | C31H30N2O3 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 3-(4-ethenylphenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide |
| SMILES | C=Cc1ccc(-c2cccc(C(=O)Nc3ccc(OCCN4CCOCC4)c4ccccc34)c2)cc1 |
| InChI | InChI=1S/C31H30N2O3/c1-2-23-10-12-24(13-11-23)25-6-5-7-26(22-25)31(34)32-29-14-15-30(28-9-4-3-8-27(28)29)36-21-18-33-16-19-35-20-17-33/h2-15,22H,1,16-21H2,(H,32,34) |
| InChIKey | GQRCQFJFKGCVOQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |