C29H27ClN2O3 — CID 59553438
3-(3-chlorophenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide (PubChem CID 59553438) has the molecular formula C29H27ClN2O3 and a molecular weight of 487.00 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide.
| Compound Name | 3-(3-chlorophenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 59553438 |
| Molecular Formula | C29H27ClN2O3 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide |
| SMILES | O=C(Nc1ccc(OCCN2CCOCC2)c2ccccc12)c1cccc(-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C29H27ClN2O3/c30-24-8-4-6-22(20-24)21-5-3-7-23(19-21)29(33)31-27-11-12-28(26-10-2-1-9-25(26)27)35-18-15-32-13-16-34-17-14-32/h1-12,19-20H,13-18H2,(H,31,33) |
| InChIKey | KPGPOVFZVLYQAM-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |