C31H32N2O5 — CID 59553486
3-(2,3-dimethoxyphenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide (PubChem CID 59553486) has the molecular formula C31H32N2O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide.
| Compound Name | 3-(2,3-dimethoxyphenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 59553486 |
| Molecular Formula | C31H32N2O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide |
| SMILES | COc1cccc(-c2cccc(C(=O)Nc3ccc(OCCN4CCOCC4)c4ccccc34)c2)c1OC |
| InChI | InChI=1S/C31H32N2O5/c1-35-29-12-6-11-24(30(29)36-2)22-7-5-8-23(21-22)31(34)32-27-13-14-28(26-10-4-3-9-25(26)27)38-20-17-33-15-18-37-19-16-33/h3-14,21H,15-20H2,1-2H3,(H,32,34) |
| InChIKey | WQFLHNSKKUOJTE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |