C30H37N5O4Si- — CID 142977964
CID 142977964 (PubChem CID 142977964) has the molecular formula C30H37N5O4Si- and a molecular weight of 559.74 g/mol.
| Compound Name | CID 142977964 |
|---|---|
| PubChem CID | 142977964 |
| Molecular Formula | C30H37N5O4Si- |
| Molecular Weight | 559.74 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | — |
| SMILES | C[Si-](C)(C)c1cc(NC(=O)Nc2ccc(OCCN3CCOCC3)c3ccccc23)n(-c2ccc(CO)cc2)n1 |
| InChI | InChI=1S/C30H37N5O4Si/c1-40(2,3)29-20-28(35(33-29)23-10-8-22(21-36)9-11-23)32-30(37)31-26-12-13-27(25-7-5-4-6-24(25)26)39-19-16-34-14-17-38-18-15-34/h4-13,20,36H,14-19,21H2,1-3H3,(H2,31,32,37)/q-1 |
| InChIKey | FJEXDWSKQGKHAS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.74 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|