C28H27ClN6O2Si — CID 90002041
1-[4-(2-chloropyrimidin-4-yl)oxynaphthalen-1-yl]-3-[1-(4-methylphenyl)-3-trimethylsilylpyrazol-5-yl]urea (PubChem CID 90002041) has the molecular formula C28H27ClN6O2Si and a molecular weight of 543.10 g/mol. Its IUPAC name is 1-[4-(2-chloropyrimidin-4-yl)oxynaphthalen-1-yl]-3-[1-(4-methylphenyl)-3-trimethylsilylpyrazol-5-yl]urea.
| Compound Name | 1-[4-(2-chloropyrimidin-4-yl)oxynaphthalen-1-yl]-3-[1-(4-methylphenyl)-3-trimethylsilylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 90002041 |
| Molecular Formula | C28H27ClN6O2Si |
| Molecular Weight | 543.10 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 1-[4-(2-chloropyrimidin-4-yl)oxynaphthalen-1-yl]-3-[1-(4-methylphenyl)-3-trimethylsilylpyrazol-5-yl]urea |
| SMILES | Cc1ccc(-n2nc([Si](C)(C)C)cc2NC(=O)Nc2ccc(Oc3ccnc(Cl)n3)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H27ClN6O2Si/c1-18-9-11-19(12-10-18)35-24(17-26(34-35)38(2,3)4)32-28(36)31-22-13-14-23(21-8-6-5-7-20(21)22)37-25-15-16-30-27(29)33-25/h5-17H,1-4H3,(H2,31,32,36) |
| InChIKey | USIPKTNBMHDENU-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.10 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|