C30H30ClIN6O2 — CID 158358605
1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-(2-chloropyrimidin-4-yl)oxynaphthalen-1-yl]urea;deuterio(iodo)methane (PubChem CID 158358605) has the molecular formula C30H30ClIN6O2 and a molecular weight of 669.97 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-(2-chloropyrimidin-4-yl)oxynaphthalen-1-yl]urea;deuterio(iodo)methane.
| Compound Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-(2-chloropyrimidin-4-yl)oxynaphthalen-1-yl]urea;deuterio(iodo)methane |
|---|---|
| PubChem CID | 158358605 |
| Molecular Formula | C30H30ClIN6O2 |
| Molecular Weight | 669.97 g/mol |
| Exact Mass | 669.12 |
| IUPAC Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-(2-chloropyrimidin-4-yl)oxynaphthalen-1-yl]urea;deuterio(iodo)methane |
| SMILES | Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(Oc3ccnc(Cl)n3)c3ccccc23)cc1.[2H]CI |
| InChI | InChI=1S/C29H27ClN6O2.CH3I/c1-18-9-11-19(12-10-18)36-25(17-24(35-36)29(2,3)4)33-28(37)32-22-13-14-23(21-8-6-5-7-20(21)22)38-26-15-16-31-27(30)34-26;1-2/h5-17H,1-4H3,(H2,32,33,37);1H3/i;1D |
| InChIKey | GTENDZLDPLFJSX-DIYDOPDJSA-N |
| XLogP | 8.56 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.97 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|