C31H32N4O5 — CID 142795433
3-[[4-(4-aminonaphthalen-1-yl)oxy-2-pyridinyl]amino]-5-ethynyl-2-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]benzamide (PubChem CID 142795433) has the molecular formula C31H32N4O5 and a molecular weight of 540.62 g/mol. Its IUPAC name is 3-[[4-(4-aminonaphthalen-1-yl)oxy-2-pyridinyl]amino]-5-ethynyl-2-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]benzamide.
| Compound Name | 3-[[4-(4-aminonaphthalen-1-yl)oxy-2-pyridinyl]amino]-5-ethynyl-2-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 142795433 |
| Molecular Formula | C31H32N4O5 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 3-[[4-(4-aminonaphthalen-1-yl)oxy-2-pyridinyl]amino]-5-ethynyl-2-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]benzamide |
| SMILES | C#Cc1cc(Nc2cc(Oc3ccc(N)c4ccccc34)ccn2)c(CCOCCOCCOC)c(C(N)=O)c1 |
| InChI | InChI=1S/C31H32N4O5/c1-3-21-18-26(31(33)36)24(11-13-38-16-17-39-15-14-37-2)28(19-21)35-30-20-22(10-12-34-30)40-29-9-8-27(32)23-6-4-5-7-25(23)29/h1,4-10,12,18-20H,11,13-17,32H2,2H3,(H2,33,36)(H,34,35) |
| InChIKey | QEYQXDLSFJWTFP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|