About 2-fluoro-3-phenylquinazolin-4-one;3-phenylquinazolin-4-one
2-fluoro-3-phenylquinazolin-4-one;3-phenylquinazolin-4-one (PubChem CID 118168715) has the molecular formula C28H19FN4O2
and a molecular weight of 462.48 g/mol. Its IUPAC name is 2-fluoro-3-phenylquinazolin-4-one;3-phenylquinazolin-4-one.
Molecular Properties
| Compound Name | 2-fluoro-3-phenylquinazolin-4-one;3-phenylquinazolin-4-one |
| PubChem CID | 118168715 |
| Molecular Formula | C28H19FN4O2 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-fluoro-3-phenylquinazolin-4-one;3-phenylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(F)n1-c1ccccc1.O=c1c2ccccc2ncn1-c1ccccc1 |
| InChI | InChI=1S/C14H9FN2O.C14H10N2O/c15-14-16-12-9-5-4-8-11(12)13(18)17(14)10-6-2-1-3-7-10;17-14-12-8-4-5-9-13(12)15-10-16(14)11-6-2-1-3-7-11/h1-9H;1-10H |
| InChIKey | MAZMUPHGCLIMRT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-fluoro-3-phenylquinazolin-4-one;3-phenylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-phenylquinazolin-4-one;3-phenylquinazolin-4-one?
The IUPAC name of 2-fluoro-3-phenylquinazolin-4-one;3-phenylquinazolin-4-one (CID 118168715) is 2-fluoro-3-phenylquinazolin-4-one;3-phenylquinazolin-4-one.
What is the SMILES notation for 2-fluoro-3-phenylquinazolin-4-one;3-phenylquinazolin-4-one?
The canonical SMILES for 2-fluoro-3-phenylquinazolin-4-one;3-phenylquinazolin-4-one is O=c1c2ccccc2nc(F)n1-c1ccccc1.O=c1c2ccccc2ncn1-c1ccccc1.
What is the InChIKey of 2-fluoro-3-phenylquinazolin-4-one;3-phenylquinazolin-4-one?
The InChIKey is MAZMUPHGCLIMRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9FN2O.C14H10N2O/c15-14-16-12-9-5-4-8-11(12)13(18)17(14)10-6-2-1-3-7-10;17-14-12-8-4-5-9-13(12)15-10-16(14)11-6-2-1-3-7-11/h1-9H;1-10H.
What are the key properties of 2-fluoro-3-phenylquinazolin-4-one;3-phenylquinazolin-4-one?
2-fluoro-3-phenylquinazolin-4-one;3-phenylquinazolin-4-one has a molecular weight of 462.48 g/mol, XLogP of 4.91, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-phenylquinazolin-4-one;3-phenylquinazolin-4-one is sourced from PubChem (CID 118168715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).