About 3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one
3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 3116934) has the molecular formula C16H8F6N2O
and a molecular weight of 358.24 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one.
Molecular Properties
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one |
| PubChem CID | 3116934 |
| Molecular Formula | C16H8F6N2O |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2ncn1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H8F6N2O/c17-15(18,19)9-5-10(16(20,21)22)7-11(6-9)24-8-23-13-4-2-1-3-12(13)14(24)25/h1-8H |
| InChIKey | UMHCXJZBBKLGSL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one?
The IUPAC name of 3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one (CID 3116934) is 3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one.
What is the SMILES notation for 3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one?
The canonical SMILES for 3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one is O=c1c2ccccc2ncn1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one?
The InChIKey is UMHCXJZBBKLGSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8F6N2O/c17-15(18,19)9-5-10(16(20,21)22)7-11(6-9)24-8-23-13-4-2-1-3-12(13)14(24)25/h1-8H.
What are the key properties of 3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one?
3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one has a molecular weight of 358.24 g/mol, XLogP of 4.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one is sourced from PubChem (CID 3116934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).