C16H8F6N2O — CID 3116934
3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 3116934) has the molecular formula C16H8F6N2O and a molecular weight of 358.24 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 3116934 |
| Molecular Formula | C16H8F6N2O |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2ncn1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H8F6N2O/c17-15(18,19)9-5-10(16(20,21)22)7-11(6-9)24-8-23-13-4-2-1-3-12(13)14(24)25/h1-8H |
| InChIKey | UMHCXJZBBKLGSL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |