C17H13F2NO3 — CID 118168964
2-[(1S)-1-[2-(difluoromethoxy)phenyl]ethyl]isoindole-1,3-dione (PubChem CID 118168964) has the molecular formula C17H13F2NO3 and a molecular weight of 317.29 g/mol. Its IUPAC name is 2-[(1S)-1-[2-(difluoromethoxy)phenyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[(1S)-1-[2-(difluoromethoxy)phenyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118168964 |
| Molecular Formula | C17H13F2NO3 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-[(1S)-1-[2-(difluoromethoxy)phenyl]ethyl]isoindole-1,3-dione |
| SMILES | C[C@@H](c1ccccc1OC(F)F)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H13F2NO3/c1-10(11-6-4-5-9-14(11)23-17(18)19)20-15(21)12-7-2-3-8-13(12)16(20)22/h2-10,17H,1H3/t10-/m0/s1 |
| InChIKey | LRVAKFKUNAJZQE-JTQLQIEISA-N |
| XLogP | 3.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|