C22H17FN2O3 — CID 118169533
2-[[(2R,3R)-1-(4-fluorophenyl)-2-(4-hydroxyphenyl)-4-oxoazetidin-3-yl]amino]benzaldehyde (PubChem CID 118169533) has the molecular formula C22H17FN2O3 and a molecular weight of 376.39 g/mol. Its IUPAC name is 2-[[(2R,3R)-1-(4-fluorophenyl)-2-(4-hydroxyphenyl)-4-oxoazetidin-3-yl]amino]benzaldehyde.
| Compound Name | 2-[[(2R,3R)-1-(4-fluorophenyl)-2-(4-hydroxyphenyl)-4-oxoazetidin-3-yl]amino]benzaldehyde |
|---|---|
| PubChem CID | 118169533 |
| Molecular Formula | C22H17FN2O3 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-[[(2R,3R)-1-(4-fluorophenyl)-2-(4-hydroxyphenyl)-4-oxoazetidin-3-yl]amino]benzaldehyde |
| SMILES | O=Cc1ccccc1N[C@H]1C(=O)N(c2ccc(F)cc2)[C@@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C22H17FN2O3/c23-16-7-9-17(10-8-16)25-21(14-5-11-18(27)12-6-14)20(22(25)28)24-19-4-2-1-3-15(19)13-26/h1-13,20-21,24,27H/t20-,21-/m1/s1 |
| InChIKey | TUIFUFNLVXULCP-NHCUHLMSSA-N |
| XLogP | 3.91 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|