C19H20ClFN2O2 — CID 118169642
1-(2-chloroacetyl)-6-[(4-fluorophenyl)methyl]-3,3,4-trimethyl-2H-pyrrolo[3,2-b]pyridin-5-one (PubChem CID 118169642) has the molecular formula C19H20ClFN2O2 and a molecular weight of 362.83 g/mol. Its IUPAC name is 1-(2-chloroacetyl)-6-[(4-fluorophenyl)methyl]-3,3,4-trimethyl-2H-pyrrolo[3,2-b]pyridin-5-one.
| Compound Name | 1-(2-chloroacetyl)-6-[(4-fluorophenyl)methyl]-3,3,4-trimethyl-2H-pyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 118169642 |
| Molecular Formula | C19H20ClFN2O2 |
| Molecular Weight | 362.83 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-(2-chloroacetyl)-6-[(4-fluorophenyl)methyl]-3,3,4-trimethyl-2H-pyrrolo[3,2-b]pyridin-5-one |
| SMILES | Cn1c2c(cc(Cc3ccc(F)cc3)c1=O)N(C(=O)CCl)CC2(C)C |
| InChI | InChI=1S/C19H20ClFN2O2/c1-19(2)11-23(16(24)10-20)15-9-13(18(25)22(3)17(15)19)8-12-4-6-14(21)7-5-12/h4-7,9H,8,10-11H2,1-3H3 |
| InChIKey | DVTKWUKHUUSVBC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.83 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|