C23H24ClFN4O3 — CID 169100727
5-(2-chloroacetyl)-8-[(4-fluorophenyl)methyl]-11-(3-hydroxycyclobutyl)-3,3-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9-trien-12-one (PubChem CID 169100727) has the molecular formula C23H24ClFN4O3 and a molecular weight of 458.92 g/mol. Its IUPAC name is 5-(2-chloroacetyl)-8-[(4-fluorophenyl)methyl]-11-(3-hydroxycyclobutyl)-3,3-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9-trien-12-one.
| Compound Name | 5-(2-chloroacetyl)-8-[(4-fluorophenyl)methyl]-11-(3-hydroxycyclobutyl)-3,3-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9-trien-12-one |
|---|---|
| PubChem CID | 169100727 |
| Molecular Formula | C23H24ClFN4O3 |
| Molecular Weight | 458.92 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 5-(2-chloroacetyl)-8-[(4-fluorophenyl)methyl]-11-(3-hydroxycyclobutyl)-3,3-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9-trien-12-one |
| SMILES | CC1(C)CN(C(=O)CCl)c2cc(Cc3ccc(F)cc3)c3nn(C4CC(O)C4)c(=O)n3c21 |
| InChI | InChI=1S/C23H24ClFN4O3/c1-23(2)12-27(19(31)11-24)18-8-14(7-13-3-5-15(25)6-4-13)21-26-29(16-9-17(30)10-16)22(32)28(21)20(18)23/h3-6,8,16-17,30H,7,9-12H2,1-2H3 |
| InChIKey | HESLAFIHWDNYSV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.92 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|