C26H29N5O6S — CID 118169885
3-[3-[(1,1-dihydroxy-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-[7-(methoxymethyl)-2H-benzotriazol-5-yl]propanoic acid (PubChem CID 118169885) has the molecular formula C26H29N5O6S and a molecular weight of 539.61 g/mol. Its IUPAC name is 3-[3-[(1,1-dihydroxy-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-[7-(methoxymethyl)-2H-benzotriazol-5-yl]propanoic acid.
| Compound Name | 3-[3-[(1,1-dihydroxy-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-[7-(methoxymethyl)-2H-benzotriazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 118169885 |
| Molecular Formula | C26H29N5O6S |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | 3-[3-[(1,1-dihydroxy-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-[7-(methoxymethyl)-2H-benzotriazol-5-yl]propanoic acid |
| SMILES | COCc1cc(C(CC(=O)O)c2ccc(C)c(CN3CCOc4ncccc4S3(O)O)c2)cc2n[nH]nc12 |
| InChI | InChI=1S/C26H29N5O6S/c1-16-5-6-17(10-19(16)14-31-8-9-37-26-23(38(31,34)35)4-3-7-27-26)21(13-24(32)33)18-11-20(15-36-2)25-22(12-18)28-30-29-25/h3-7,10-12,21,34-35H,8-9,13-15H2,1-2H3,(H,32,33)(H,28,29,30) |
| InChIKey | GCUJRFWFTLKHNT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 153.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |