C19H20BrN3O2 — CID 118170425
3-[3-(bromomethyl)-4-methylphenyl]-3-(1,4-dimethylbenzotriazol-5-yl)propanoic acid (PubChem CID 118170425) has the molecular formula C19H20BrN3O2 and a molecular weight of 402.29 g/mol. Its IUPAC name is 3-[3-(bromomethyl)-4-methylphenyl]-3-(1,4-dimethylbenzotriazol-5-yl)propanoic acid.
| Compound Name | 3-[3-(bromomethyl)-4-methylphenyl]-3-(1,4-dimethylbenzotriazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 118170425 |
| Molecular Formula | C19H20BrN3O2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 3-[3-(bromomethyl)-4-methylphenyl]-3-(1,4-dimethylbenzotriazol-5-yl)propanoic acid |
| SMILES | Cc1ccc(C(CC(=O)O)c2ccc3c(nnn3C)c2C)cc1CBr |
| InChI | InChI=1S/C19H20BrN3O2/c1-11-4-5-13(8-14(11)10-20)16(9-18(24)25)15-6-7-17-19(12(15)2)21-22-23(17)3/h4-8,16H,9-10H2,1-3H3,(H,24,25) |
| InChIKey | JVDFHKLIUHFSTF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|