C27H29N5O3S — CID 123714426
3-(1,4-dimethylbenzotriazol-5-yl)-3-[4-methyl-3-[(4-methyl-3,4-dihydropyrido[3,4-b][1,4,5]oxathiazepin-2-yl)methyl]phenyl]propanoic acid (PubChem CID 123714426) has the molecular formula C27H29N5O3S and a molecular weight of 503.63 g/mol. Its IUPAC name is 3-(1,4-dimethylbenzotriazol-5-yl)-3-[4-methyl-3-[(4-methyl-3,4-dihydropyrido[3,4-b][1,4,5]oxathiazepin-2-yl)methyl]phenyl]propanoic acid.
| Compound Name | 3-(1,4-dimethylbenzotriazol-5-yl)-3-[4-methyl-3-[(4-methyl-3,4-dihydropyrido[3,4-b][1,4,5]oxathiazepin-2-yl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 123714426 |
| Molecular Formula | C27H29N5O3S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 3-(1,4-dimethylbenzotriazol-5-yl)-3-[4-methyl-3-[(4-methyl-3,4-dihydropyrido[3,4-b][1,4,5]oxathiazepin-2-yl)methyl]phenyl]propanoic acid |
| SMILES | Cc1ccc(C(CC(=O)O)c2ccc3c(nnn3C)c2C)cc1CN1CC(C)Oc2cnccc2S1 |
| InChI | InChI=1S/C27H29N5O3S/c1-16-5-6-19(11-20(16)15-32-14-17(2)35-24-13-28-10-9-25(24)36-32)22(12-26(33)34)21-7-8-23-27(18(21)3)29-30-31(23)4/h5-11,13,17,22H,12,14-15H2,1-4H3,(H,33,34) |
| InChIKey | UHBWKYAVONAJMG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|