C30H32N2O7S — CID 118170637
3-[3-[[(4R)-1,1-dihydroxy-4-methyl-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-(2-ethyl-1,3-dioxoisoindol-5-yl)propanoic acid (PubChem CID 118170637) has the molecular formula C30H32N2O7S and a molecular weight of 564.66 g/mol. Its IUPAC name is 3-[3-[[(4R)-1,1-dihydroxy-4-methyl-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-(2-ethyl-1,3-dioxoisoindol-5-yl)propanoic acid.
| Compound Name | 3-[3-[[(4R)-1,1-dihydroxy-4-methyl-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-(2-ethyl-1,3-dioxoisoindol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 118170637 |
| Molecular Formula | C30H32N2O7S |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 3-[3-[[(4R)-1,1-dihydroxy-4-methyl-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-(2-ethyl-1,3-dioxoisoindol-5-yl)propanoic acid |
| SMILES | CCN1C(=O)c2ccc(C(CC(=O)O)c3ccc(C)c(CN4C[C@@H](C)Oc5ccccc5S4(O)O)c3)cc2C1=O |
| InChI | InChI=1S/C30H32N2O7S/c1-4-32-29(35)23-12-11-21(14-25(23)30(32)36)24(15-28(33)34)20-10-9-18(2)22(13-20)17-31-16-19(3)39-26-7-5-6-8-27(26)40(31,37)38/h5-14,19,24,37-38H,4,15-17H2,1-3H3,(H,33,34)/t19-,24?/m1/s1 |
| InChIKey | NUDMJVZXKWYIFT-PHSANKKPSA-N |
| XLogP | 5.53 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|