C26H24F3NO5S — CID 118170539
3-[4-methyl-3-[[(4R)-4-methyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]phenyl]-3-(3,4,5-trifluorophenyl)propanoic acid (PubChem CID 118170539) has the molecular formula C26H24F3NO5S and a molecular weight of 519.54 g/mol. Its IUPAC name is 3-[4-methyl-3-[[(4R)-4-methyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]phenyl]-3-(3,4,5-trifluorophenyl)propanoic acid.
| Compound Name | 3-[4-methyl-3-[[(4R)-4-methyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]phenyl]-3-(3,4,5-trifluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 118170539 |
| Molecular Formula | C26H24F3NO5S |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 3-[4-methyl-3-[[(4R)-4-methyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]phenyl]-3-(3,4,5-trifluorophenyl)propanoic acid |
| SMILES | Cc1ccc(C(CC(=O)O)c2cc(F)c(F)c(F)c2)cc1CN1C[C@@H](C)Oc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C26H24F3NO5S/c1-15-7-8-17(20(12-25(31)32)18-10-21(27)26(29)22(28)11-18)9-19(15)14-30-13-16(2)35-23-5-3-4-6-24(23)36(30,33)34/h3-11,16,20H,12-14H2,1-2H3,(H,31,32)/t16-,20?/m1/s1 |
| InChIKey | FRPGONVMQZYDCC-QRIPLOBPSA-N |
| XLogP | 4.99 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|