C31H36N2O5S — CID 123671316
3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)propanoic acid (PubChem CID 123671316) has the molecular formula C31H36N2O5S and a molecular weight of 548.71 g/mol. Its IUPAC name is 3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)propanoic acid.
| Compound Name | 3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)propanoic acid |
|---|---|
| PubChem CID | 123671316 |
| Molecular Formula | C31H36N2O5S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)propanoic acid |
| SMILES | CCC1CN(Cc2cc(C(CC(=O)O)c3ccc4c(c3)CN(C)CC4)ccc2C)S(=O)(=O)c2ccccc2O1 |
| InChI | InChI=1S/C31H36N2O5S/c1-4-27-20-33(39(36,37)30-8-6-5-7-29(30)38-27)19-25-15-23(10-9-21(25)2)28(17-31(34)35)24-12-11-22-13-14-32(3)18-26(22)16-24/h5-12,15-16,27-28H,4,13-14,17-20H2,1-3H3,(H,34,35) |
| InChIKey | QLBKVJGMFUFAFO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |