C54H68N8O10S2 — CID 159185911
3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-5-(1-ethyltriazol-4-yl)pentanoic acid (PubChem CID 159185911) has the molecular formula C54H68N8O10S2 and a molecular weight of 1053.32 g/mol. Its IUPAC name is 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-5-(1-ethyltriazol-4-yl)pentanoic acid.
| Compound Name | 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-5-(1-ethyltriazol-4-yl)pentanoic acid |
|---|---|
| PubChem CID | 159185911 |
| Molecular Formula | C54H68N8O10S2 |
| Molecular Weight | 1053.32 g/mol |
| Exact Mass | 1052.45 |
| IUPAC Name | 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-5-(1-ethyltriazol-4-yl)pentanoic acid |
| SMILES | CC[C@@H]1CN(Cc2cc(C(CCc3cn(CC)nn3)CC(=O)O)ccc2C)S(=O)(=O)c2ccccc2O1.CC[C@@H]1CN(Cc2cc(C(CCc3cn(CC)nn3)CC(=O)O)ccc2C)S(=O)(=O)c2ccccc2O1 |
| InChI | InChI=1S/2C27H34N4O5S/c2*1-4-24-18-31(37(34,35)26-9-7-6-8-25(26)36-24)16-22-14-20(11-10-19(22)3)21(15-27(32)33)12-13-23-17-30(5-2)29-28-23/h2*6-11,14,17,21,24H,4-5,12-13,15-16,18H2,1-3H3,(H,32,33)/t2*21?,24-/m11/s1 |
| InChIKey | KNMFFDNYJPXYOM-MALDNUOBSA-N |
| XLogP | 8.32 |
| TPSA | 229.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1053.32 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |