C30H40N4O5S — CID 135124372
(3R)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethyl-5-(1-propyltriazol-4-yl)pentanoic acid (PubChem CID 135124372) has the molecular formula C30H40N4O5S and a molecular weight of 568.74 g/mol. Its IUPAC name is (3R)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethyl-5-(1-propyltriazol-4-yl)pentanoic acid.
| Compound Name | (3R)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethyl-5-(1-propyltriazol-4-yl)pentanoic acid |
|---|---|
| PubChem CID | 135124372 |
| Molecular Formula | C30H40N4O5S |
| Molecular Weight | 568.74 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | (3R)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethyl-5-(1-propyltriazol-4-yl)pentanoic acid |
| SMILES | CCCn1cc(CC[C@H](c2ccc(C)c(CN3C[C@@H](CC)Oc4ccccc4S3(=O)=O)c2)C(C)(C)C(=O)O)nn1 |
| InChI | InChI=1S/C30H40N4O5S/c1-6-16-33-19-24(31-32-33)14-15-26(30(4,5)29(35)36)22-13-12-21(3)23(17-22)18-34-20-25(7-2)39-27-10-8-9-11-28(27)40(34,37)38/h8-13,17,19,25-26H,6-7,14-16,18,20H2,1-5H3,(H,35,36)/t25-,26-/m1/s1 |
| InChIKey | NWQBKJXGWPIGHD-CLJLJLNGSA-N |
| XLogP | 5.19 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.74 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |