C29H38N4O6S — CID 146437772
3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-dimethyl-3-[(1-propyltriazol-4-yl)methoxy]propanoic acid (PubChem CID 146437772) has the molecular formula C29H38N4O6S and a molecular weight of 570.71 g/mol. Its IUPAC name is 3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-dimethyl-3-[(1-propyltriazol-4-yl)methoxy]propanoic acid.
| Compound Name | 3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-dimethyl-3-[(1-propyltriazol-4-yl)methoxy]propanoic acid |
|---|---|
| PubChem CID | 146437772 |
| Molecular Formula | C29H38N4O6S |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-dimethyl-3-[(1-propyltriazol-4-yl)methoxy]propanoic acid |
| SMILES | CCCn1cc(COC(c2ccc(C)c(CN3CC(CC)Oc4ccccc4S3(=O)=O)c2)C(C)(C)C(=O)O)nn1 |
| InChI | InChI=1S/C29H38N4O6S/c1-6-14-32-17-23(30-31-32)19-38-27(29(4,5)28(34)35)21-13-12-20(3)22(15-21)16-33-18-24(7-2)39-25-10-8-9-11-26(25)40(33,36)37/h8-13,15,17,24,27H,6-7,14,16,18-19H2,1-5H3,(H,34,35) |
| InChIKey | SMWOETNUBXEWEQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |