C19H26ClN3O3 — CID 135124011
3-[3-(chloromethyl)-4-methylphenyl]-2,2-dimethyl-3-[(1-propyltriazol-4-yl)methoxy]propanoic acid (PubChem CID 135124011) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is 3-[3-(chloromethyl)-4-methylphenyl]-2,2-dimethyl-3-[(1-propyltriazol-4-yl)methoxy]propanoic acid.
| Compound Name | 3-[3-(chloromethyl)-4-methylphenyl]-2,2-dimethyl-3-[(1-propyltriazol-4-yl)methoxy]propanoic acid |
|---|---|
| PubChem CID | 135124011 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 3-[3-(chloromethyl)-4-methylphenyl]-2,2-dimethyl-3-[(1-propyltriazol-4-yl)methoxy]propanoic acid |
| SMILES | CCCn1cc(COC(c2ccc(C)c(CCl)c2)C(C)(C)C(=O)O)nn1 |
| InChI | InChI=1S/C19H26ClN3O3/c1-5-8-23-11-16(21-22-23)12-26-17(19(3,4)18(24)25)14-7-6-13(2)15(9-14)10-20/h6-7,9,11,17H,5,8,10,12H2,1-4H3,(H,24,25) |
| InChIKey | BFHNDQDCZCWLGH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|