C34H42N6O5S — CID 146220448
3-[3-[(4,4-dimethyl-1,1-dioxo-3H-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-dimethyl-3-[(1-propyltriazol-4-yl)methoxy]-N-pyridin-3-ylpropanamide (PubChem CID 146220448) has the molecular formula C34H42N6O5S and a molecular weight of 646.81 g/mol. Its IUPAC name is 3-[3-[(4,4-dimethyl-1,1-dioxo-3H-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-dimethyl-3-[(1-propyltriazol-4-yl)methoxy]-N-pyridin-3-ylpropanamide.
| Compound Name | 3-[3-[(4,4-dimethyl-1,1-dioxo-3H-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-dimethyl-3-[(1-propyltriazol-4-yl)methoxy]-N-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 146220448 |
| Molecular Formula | C34H42N6O5S |
| Molecular Weight | 646.81 g/mol |
| Exact Mass | 646.29 |
| IUPAC Name | 3-[3-[(4,4-dimethyl-1,1-dioxo-3H-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-dimethyl-3-[(1-propyltriazol-4-yl)methoxy]-N-pyridin-3-ylpropanamide |
| SMILES | CCCn1cc(COC(c2ccc(C)c(CN3CC(C)(C)Oc4ccccc4S3(=O)=O)c2)C(C)(C)C(=O)Nc2cccnc2)nn1 |
| InChI | InChI=1S/C34H42N6O5S/c1-7-17-39-21-28(37-38-39)22-44-31(34(5,6)32(41)36-27-11-10-16-35-19-27)25-15-14-24(2)26(18-25)20-40-23-33(3,4)45-29-12-8-9-13-30(29)46(40,42)43/h8-16,18-19,21,31H,7,17,20,22-23H2,1-6H3,(H,36,41) |
| InChIKey | GQPGWLCWTKKUDA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.81 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |