C37H46N4O5S — CID 142376452
benzyl (3S)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethyl-5-(1-propyltriazol-4-yl)pentanoate (PubChem CID 142376452) has the molecular formula C37H46N4O5S and a molecular weight of 658.87 g/mol. Its IUPAC name is benzyl (3S)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethyl-5-(1-propyltriazol-4-yl)pentanoate.
| Compound Name | benzyl (3S)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethyl-5-(1-propyltriazol-4-yl)pentanoate |
|---|---|
| PubChem CID | 142376452 |
| Molecular Formula | C37H46N4O5S |
| Molecular Weight | 658.87 g/mol |
| Exact Mass | 658.32 |
| IUPAC Name | benzyl (3S)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethyl-5-(1-propyltriazol-4-yl)pentanoate |
| SMILES | CCCn1cc(CC[C@@H](c2ccc(C)c(CN3C[C@@H](CC)Oc4ccccc4S3(=O)=O)c2)C(C)(C)C(=O)OCc2ccccc2)nn1 |
| InChI | InChI=1S/C37H46N4O5S/c1-6-21-40-24-31(38-39-40)19-20-33(37(4,5)36(42)45-26-28-13-9-8-10-14-28)29-18-17-27(3)30(22-29)23-41-25-32(7-2)46-34-15-11-12-16-35(34)47(41,43)44/h8-18,22,24,32-33H,6-7,19-21,23,25-26H2,1-5H3/t32-,33+/m1/s1 |
| InChIKey | OKKHZQFGUOULEO-SAIUNTKASA-N |
| XLogP | 6.84 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.87 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |