C35H46N4O5S — CID 135142034
benzyl (Z)-6-amino-7-[amino(propyl)amino]-3-[3-[(1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-dimethylhept-6-enoate (PubChem CID 135142034) has the molecular formula C35H46N4O5S and a molecular weight of 634.84 g/mol. Its IUPAC name is benzyl (Z)-6-amino-7-[amino(propyl)amino]-3-[3-[(1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-dimethylhept-6-enoate.
| Compound Name | benzyl (Z)-6-amino-7-[amino(propyl)amino]-3-[3-[(1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-dimethylhept-6-enoate |
|---|---|
| PubChem CID | 135142034 |
| Molecular Formula | C35H46N4O5S |
| Molecular Weight | 634.84 g/mol |
| Exact Mass | 634.32 |
| IUPAC Name | benzyl (Z)-6-amino-7-[amino(propyl)amino]-3-[3-[(1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-dimethylhept-6-enoate |
| SMILES | CCCN(N)/C=C(\N)CCC(c1ccc(C)c(CN2CCOc3ccccc3S2(=O)=O)c1)C(C)(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H46N4O5S/c1-5-19-38(37)24-30(36)17-18-31(35(3,4)34(40)44-25-27-11-7-6-8-12-27)28-16-15-26(2)29(22-28)23-39-20-21-43-32-13-9-10-14-33(32)45(39,41)42/h6-16,22,24,31H,5,17-21,23,25,36-37H2,1-4H3/b30-24- |
| InChIKey | YZCMGOHGDSFGHV-KRUMMXJUSA-N |
| XLogP | 5.60 |
| TPSA | 128.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.84 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|