C30H46N4O3 — CID 145208702
(Z)-6-amino-3-[3-(3,5-dihydro-2H-pyrido[2,3-f][1,4]oxazepin-4-ylmethyl)-4-methylphenyl]-7-(ethylamino)-2,2-dimethylhept-6-enoic acid;propane (PubChem CID 145208702) has the molecular formula C30H46N4O3 and a molecular weight of 510.72 g/mol. Its IUPAC name is (Z)-6-amino-3-[3-(3,5-dihydro-2H-pyrido[2,3-f][1,4]oxazepin-4-ylmethyl)-4-methylphenyl]-7-(ethylamino)-2,2-dimethylhept-6-enoic acid;propane.
| Compound Name | (Z)-6-amino-3-[3-(3,5-dihydro-2H-pyrido[2,3-f][1,4]oxazepin-4-ylmethyl)-4-methylphenyl]-7-(ethylamino)-2,2-dimethylhept-6-enoic acid;propane |
|---|---|
| PubChem CID | 145208702 |
| Molecular Formula | C30H46N4O3 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.36 |
| IUPAC Name | (Z)-6-amino-3-[3-(3,5-dihydro-2H-pyrido[2,3-f][1,4]oxazepin-4-ylmethyl)-4-methylphenyl]-7-(ethylamino)-2,2-dimethylhept-6-enoic acid;propane |
| SMILES | CCC.CCN/C=C(\N)CCC(c1ccc(C)c(CN2CCOc3cccnc3C2)c1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C27H38N4O3.C3H8/c1-5-29-16-22(28)10-11-23(27(3,4)26(32)33)20-9-8-19(2)21(15-20)17-31-13-14-34-25-7-6-12-30-24(25)18-31;1-3-2/h6-9,12,15-16,23,29H,5,10-11,13-14,17-18,28H2,1-4H3,(H,32,33);3H2,1-2H3/b22-16-; |
| InChIKey | LPGAINFLPZDFMC-IVVDCSPYSA-N |
| XLogP | 5.59 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |