C36H49N5O3 — CID 145208432
benzyl (Z)-6-amino-7-[amino(ethyl)amino]-3-[3-[(2,2-dimethyl-3,5-dihydropyrido[3,2-f][1,4]oxazepin-4-yl)methyl]-4-methylphenyl]-2,2-dimethylhept-6-enoate (PubChem CID 145208432) has the molecular formula C36H49N5O3 and a molecular weight of 599.82 g/mol. Its IUPAC name is benzyl (Z)-6-amino-7-[amino(ethyl)amino]-3-[3-[(2,2-dimethyl-3,5-dihydropyrido[3,2-f][1,4]oxazepin-4-yl)methyl]-4-methylphenyl]-2,2-dimethylhept-6-enoate.
| Compound Name | benzyl (Z)-6-amino-7-[amino(ethyl)amino]-3-[3-[(2,2-dimethyl-3,5-dihydropyrido[3,2-f][1,4]oxazepin-4-yl)methyl]-4-methylphenyl]-2,2-dimethylhept-6-enoate |
|---|---|
| PubChem CID | 145208432 |
| Molecular Formula | C36H49N5O3 |
| Molecular Weight | 599.82 g/mol |
| Exact Mass | 599.38 |
| IUPAC Name | benzyl (Z)-6-amino-7-[amino(ethyl)amino]-3-[3-[(2,2-dimethyl-3,5-dihydropyrido[3,2-f][1,4]oxazepin-4-yl)methyl]-4-methylphenyl]-2,2-dimethylhept-6-enoate |
| SMILES | CCN(N)/C=C(\N)CCC(c1ccc(C)c(CN2Cc3cccnc3OC(C)(C)C2)c1)C(C)(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H49N5O3/c1-7-41(38)23-31(37)17-18-32(36(5,6)34(42)43-24-27-12-9-8-10-13-27)28-16-15-26(2)30(20-28)22-40-21-29-14-11-19-39-33(29)44-35(3,4)25-40/h8-16,19-20,23,32H,7,17-18,21-22,24-25,37-38H2,1-6H3/b31-23- |
| InChIKey | CIGUJBWLBQXNEC-SXBRIOAWSA-N |
| XLogP | 6.19 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.82 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|