C36H52N6O — CID 145208753
(Z)-7-amino-8-[amino(ethyl)amino]-4-[3-[[2-[(4-ethylpiperidin-1-yl)methyl]imidazol-1-yl]methyl]-4-methylphenyl]-3-methyl-1-phenyloct-7-en-2-one (PubChem CID 145208753) has the molecular formula C36H52N6O and a molecular weight of 584.85 g/mol. Its IUPAC name is (Z)-7-amino-8-[amino(ethyl)amino]-4-[3-[[2-[(4-ethylpiperidin-1-yl)methyl]imidazol-1-yl]methyl]-4-methylphenyl]-3-methyl-1-phenyloct-7-en-2-one.
| Compound Name | (Z)-7-amino-8-[amino(ethyl)amino]-4-[3-[[2-[(4-ethylpiperidin-1-yl)methyl]imidazol-1-yl]methyl]-4-methylphenyl]-3-methyl-1-phenyloct-7-en-2-one |
|---|---|
| PubChem CID | 145208753 |
| Molecular Formula | C36H52N6O |
| Molecular Weight | 584.85 g/mol |
| Exact Mass | 584.42 |
| IUPAC Name | (Z)-7-amino-8-[amino(ethyl)amino]-4-[3-[[2-[(4-ethylpiperidin-1-yl)methyl]imidazol-1-yl]methyl]-4-methylphenyl]-3-methyl-1-phenyloct-7-en-2-one |
| SMILES | CCC1CCN(Cc2nccn2Cc2cc(C(CC/C(N)=C/N(N)CC)C(C)C(=O)Cc3ccccc3)ccc2C)CC1 |
| InChI | InChI=1S/C36H52N6O/c1-5-29-16-19-40(20-17-29)26-36-39-18-21-41(36)24-32-23-31(13-12-27(32)3)34(15-14-33(37)25-42(38)6-2)28(4)35(43)22-30-10-8-7-9-11-30/h7-13,18,21,23,25,28-29,34H,5-6,14-17,19-20,22,24,26,37-38H2,1-4H3/b33-25- |
| InChIKey | WZCMLRVQAWXPRX-IVQJCJPDSA-N |
| XLogP | 6.17 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.85 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|