C30H42N6O3 — CID 145208692
3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[[2-(1,4-oxazepan-4-ylmethyl)imidazol-1-yl]methyl]phenyl]propanoic acid (PubChem CID 145208692) has the molecular formula C30H42N6O3 and a molecular weight of 534.71 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[[2-(1,4-oxazepan-4-ylmethyl)imidazol-1-yl]methyl]phenyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[[2-(1,4-oxazepan-4-ylmethyl)imidazol-1-yl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 145208692 |
| Molecular Formula | C30H42N6O3 |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[[2-(1,4-oxazepan-4-ylmethyl)imidazol-1-yl]methyl]phenyl]propanoic acid |
| SMILES | Cc1ccc(C(c2ccc(N(C)N)c(N)c2C)C(C)(C)C(=O)O)cc1Cn1ccnc1CN1CCCOCC1 |
| InChI | InChI=1S/C30H42N6O3/c1-20-7-8-22(17-23(20)18-36-13-11-33-26(36)19-35-12-6-15-39-16-14-35)27(30(3,4)29(37)38)24-9-10-25(34(5)32)28(31)21(24)2/h7-11,13,17,27H,6,12,14-16,18-19,31-32H2,1-5H3,(H,37,38) |
| InChIKey | MXOJVOURUUWOJY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|