C31H38N6O2 — CID 155364175
3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-(1,7,8,10-tetrahydropyrazolo[5,4-g][1,4]benzoxazepin-9-ylmethyl)phenyl]propanal (PubChem CID 155364175) has the molecular formula C31H38N6O2 and a molecular weight of 526.69 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-(1,7,8,10-tetrahydropyrazolo[5,4-g][1,4]benzoxazepin-9-ylmethyl)phenyl]propanal.
| Compound Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-(1,7,8,10-tetrahydropyrazolo[5,4-g][1,4]benzoxazepin-9-ylmethyl)phenyl]propanal |
|---|---|
| PubChem CID | 155364175 |
| Molecular Formula | C31H38N6O2 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-(1,7,8,10-tetrahydropyrazolo[5,4-g][1,4]benzoxazepin-9-ylmethyl)phenyl]propanal |
| SMILES | Cc1ccc(C(c2ccc(N(C)N)c(N)c2C)C(C)(C)C=O)cc1CN1CCOc2ccc3cn[nH]c3c2C1 |
| InChI | InChI=1S/C31H38N6O2/c1-19-6-7-21(28(31(3,4)18-38)24-9-10-26(36(5)33)29(32)20(24)2)14-23(19)16-37-12-13-39-27-11-8-22-15-34-35-30(22)25(27)17-37/h6-11,14-15,18,28H,12-13,16-17,32-33H2,1-5H3,(H,34,35) |
| InChIKey | SSHXMLSEBHJPBL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|