C32H41N5O — CID 155364183
4-[2,2-dimethyl-1-[4-methyl-3-[(2-methyl-8,10-dihydro-7H-pyrazolo[3,4-g][1,4]benzoxazepin-9-yl)methyl]phenyl]propyl]-1-N,3-dimethylbenzene-1,2-diamine (PubChem CID 155364183) has the molecular formula C32H41N5O and a molecular weight of 511.71 g/mol. Its IUPAC name is 4-[2,2-dimethyl-1-[4-methyl-3-[(2-methyl-8,10-dihydro-7H-pyrazolo[3,4-g][1,4]benzoxazepin-9-yl)methyl]phenyl]propyl]-1-N,3-dimethylbenzene-1,2-diamine.
| Compound Name | 4-[2,2-dimethyl-1-[4-methyl-3-[(2-methyl-8,10-dihydro-7H-pyrazolo[3,4-g][1,4]benzoxazepin-9-yl)methyl]phenyl]propyl]-1-N,3-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 155364183 |
| Molecular Formula | C32H41N5O |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.33 |
| IUPAC Name | 4-[2,2-dimethyl-1-[4-methyl-3-[(2-methyl-8,10-dihydro-7H-pyrazolo[3,4-g][1,4]benzoxazepin-9-yl)methyl]phenyl]propyl]-1-N,3-dimethylbenzene-1,2-diamine |
| SMILES | CNc1ccc(C(c2ccc(C)c(CN3CCOc4ccc5cn(C)nc5c4C3)c2)C(C)(C)C)c(C)c1N |
| InChI | InChI=1S/C32H41N5O/c1-20-8-9-22(29(32(3,4)5)25-11-12-27(34-6)30(33)21(25)2)16-24(20)18-37-14-15-38-28-13-10-23-17-36(7)35-31(23)26(28)19-37/h8-13,16-17,29,34H,14-15,18-19,33H2,1-7H3 |
| InChIKey | FQILQYGRTGTXSK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|