C34H39BrN6O4S — CID 166852410
3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-[3-[(8-bromo-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-dimethyl-N-pyrimidin-5-ylpropanamide (PubChem CID 166852410) has the molecular formula C34H39BrN6O4S and a molecular weight of 707.70 g/mol. Its IUPAC name is 3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-[3-[(8-bromo-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-dimethyl-N-pyrimidin-5-ylpropanamide.
| Compound Name | 3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-[3-[(8-bromo-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-dimethyl-N-pyrimidin-5-ylpropanamide |
|---|---|
| PubChem CID | 166852410 |
| Molecular Formula | C34H39BrN6O4S |
| Molecular Weight | 707.70 g/mol |
| Exact Mass | 706.19 |
| IUPAC Name | 3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-[3-[(8-bromo-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-dimethyl-N-pyrimidin-5-ylpropanamide |
| SMILES | CCNc1ccc(C(c2ccc(C)c(CN3CCOc4ccc(Br)cc4S3(=O)=O)c2)C(C)(C)C(=O)Nc2cncnc2)c(C)c1N |
| InChI | InChI=1S/C34H39BrN6O4S/c1-6-39-28-11-10-27(22(3)32(28)36)31(34(4,5)33(42)40-26-17-37-20-38-18-26)23-8-7-21(2)24(15-23)19-41-13-14-45-29-12-9-25(35)16-30(29)46(41,43)44/h7-12,15-18,20,31,39H,6,13-14,19,36H2,1-5H3,(H,40,42) |
| InChIKey | VIQQPUVNRXYGBH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.70 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|