C26H29ClN4O5S — CID 135142024
3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-[4-chloro-3-[(1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]phenyl]propanoic acid (PubChem CID 135142024) has the molecular formula C26H29ClN4O5S and a molecular weight of 545.06 g/mol. Its IUPAC name is 3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-[4-chloro-3-[(1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]phenyl]propanoic acid.
| Compound Name | 3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-[4-chloro-3-[(1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 135142024 |
| Molecular Formula | C26H29ClN4O5S |
| Molecular Weight | 545.06 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-[4-chloro-3-[(1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]phenyl]propanoic acid |
| SMILES | CCNc1ccc(C(CC(=O)O)c2ccc(Cl)c(CN3CCOc4ncccc4S3(=O)=O)c2)c(C)c1N |
| InChI | InChI=1S/C26H29ClN4O5S/c1-3-29-22-9-7-19(16(2)25(22)28)20(14-24(32)33)17-6-8-21(27)18(13-17)15-31-11-12-36-26-23(37(31,34)35)5-4-10-30-26/h4-10,13,20,29H,3,11-12,14-15,28H2,1-2H3,(H,32,33) |
| InChIKey | OMMAIBXLTVNORU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 134.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.06 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|