C28H29N3O5S — CID 140750351
3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(4-isocyano-2-methylphenyl)propanoic acid (PubChem CID 140750351) has the molecular formula C28H29N3O5S and a molecular weight of 519.62 g/mol. Its IUPAC name is 3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(4-isocyano-2-methylphenyl)propanoic acid.
| Compound Name | 3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(4-isocyano-2-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 140750351 |
| Molecular Formula | C28H29N3O5S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(4-isocyano-2-methylphenyl)propanoic acid |
| SMILES | [C-]#[N+]c1ccc(C(CC(=O)O)c2ccc(C)c(CN3CC(CC)Oc4ncccc4S3(=O)=O)c2)c(C)c1 |
| InChI | InChI=1S/C28H29N3O5S/c1-5-23-17-31(37(34,35)26-7-6-12-30-28(26)36-23)16-21-14-20(9-8-18(21)2)25(15-27(32)33)24-11-10-22(29-4)13-19(24)3/h6-14,23,25H,5,15-17H2,1-3H3,(H,32,33) |
| InChIKey | IQNVDSYMCAFJSL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|