C33H39N7O4S — CID 135123891
(3S)-N-(3-cyanopropyl)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-3-(1-ethyl-4-methylbenzotriazol-5-yl)propanamide (PubChem CID 135123891) has the molecular formula C33H39N7O4S and a molecular weight of 629.79 g/mol. Its IUPAC name is (3S)-N-(3-cyanopropyl)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-3-(1-ethyl-4-methylbenzotriazol-5-yl)propanamide.
| Compound Name | (3S)-N-(3-cyanopropyl)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-3-(1-ethyl-4-methylbenzotriazol-5-yl)propanamide |
|---|---|
| PubChem CID | 135123891 |
| Molecular Formula | C33H39N7O4S |
| Molecular Weight | 629.79 g/mol |
| Exact Mass | 629.28 |
| IUPAC Name | (3S)-N-(3-cyanopropyl)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-3-(1-ethyl-4-methylbenzotriazol-5-yl)propanamide |
| SMILES | CC[C@@H]1CN(Cc2cc([C@H](CC(=O)NCCCC#N)c3ccc4c(nnn4CC)c3C)ccc2C)S(=O)(=O)c2cccnc2O1 |
| InChI | InChI=1S/C33H39N7O4S/c1-5-26-21-39(45(42,43)30-10-9-17-36-33(30)44-26)20-25-18-24(12-11-22(25)3)28(19-31(41)35-16-8-7-15-34)27-13-14-29-32(23(27)4)37-38-40(29)6-2/h9-14,17-18,26,28H,5-8,16,19-21H2,1-4H3,(H,35,41)/t26-,28+/m1/s1 |
| InChIKey | XJYXGNBWVJNUAV-IAPPQJPRSA-N |
| XLogP | 4.77 |
| TPSA | 143.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.79 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|