C28H30ClN5O5S — CID 135123305
3-[4-chloro-3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl]methyl]phenyl]-3-(1-ethyl-4-methylbenzotriazol-5-yl)propanoic acid (PubChem CID 135123305) has the molecular formula C28H30ClN5O5S and a molecular weight of 584.10 g/mol. Its IUPAC name is 3-[4-chloro-3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl]methyl]phenyl]-3-(1-ethyl-4-methylbenzotriazol-5-yl)propanoic acid.
| Compound Name | 3-[4-chloro-3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl]methyl]phenyl]-3-(1-ethyl-4-methylbenzotriazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 135123305 |
| Molecular Formula | C28H30ClN5O5S |
| Molecular Weight | 584.10 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | 3-[4-chloro-3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl]methyl]phenyl]-3-(1-ethyl-4-methylbenzotriazol-5-yl)propanoic acid |
| SMILES | CC[C@@H]1CN(Cc2cc(C(CC(=O)O)c3ccc4c(nnn4CC)c3C)ccc2Cl)S(=O)(=O)c2cccnc2O1 |
| InChI | InChI=1S/C28H30ClN5O5S/c1-4-20-16-33(40(37,38)25-7-6-12-30-28(25)39-20)15-19-13-18(8-10-23(19)29)22(14-26(35)36)21-9-11-24-27(17(21)3)31-32-34(24)5-2/h6-13,20,22H,4-5,14-16H2,1-3H3,(H,35,36)/t20-,22?/m1/s1 |
| InChIKey | NWDGCOBFOUTMBY-PSDZMVHGSA-N |
| XLogP | 4.78 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.10 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |