C32H40N6O5S — CID 135124877
3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-3-(1-ethyl-4-methylbenzotriazol-5-yl)-N-(3-hydroxypropyl)propanamide (PubChem CID 135124877) has the molecular formula C32H40N6O5S and a molecular weight of 620.78 g/mol. Its IUPAC name is 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-3-(1-ethyl-4-methylbenzotriazol-5-yl)-N-(3-hydroxypropyl)propanamide.
| Compound Name | 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-3-(1-ethyl-4-methylbenzotriazol-5-yl)-N-(3-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 135124877 |
| Molecular Formula | C32H40N6O5S |
| Molecular Weight | 620.78 g/mol |
| Exact Mass | 620.28 |
| IUPAC Name | 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-3-(1-ethyl-4-methylbenzotriazol-5-yl)-N-(3-hydroxypropyl)propanamide |
| SMILES | CC[C@@H]1CN(Cc2cc(C(CC(=O)NCCCO)c3ccc4c(nnn4CC)c3C)ccc2C)S(=O)(=O)c2cccnc2O1 |
| InChI | InChI=1S/C32H40N6O5S/c1-5-25-20-37(44(41,42)29-9-7-14-34-32(29)43-25)19-24-17-23(11-10-21(24)3)27(18-30(40)33-15-8-16-39)26-12-13-28-31(22(26)4)35-36-38(28)6-2/h7,9-14,17,25,27,39H,5-6,8,15-16,18-20H2,1-4H3,(H,33,40)/t25-,27?/m1/s1 |
| InChIKey | BKJWCOUWFFIFMA-CSMDKSQMSA-N |
| XLogP | 3.85 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|