C27H34N4OS — CID 166852494
4-[(1S)-1-[3-(3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-ylmethyl)-4-methylphenyl]propyl]-1-N-ethyl-3-methylbenzene-1,2-diamine (PubChem CID 166852494) has the molecular formula C27H34N4OS and a molecular weight of 462.66 g/mol. Its IUPAC name is 4-[(1S)-1-[3-(3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-ylmethyl)-4-methylphenyl]propyl]-1-N-ethyl-3-methylbenzene-1,2-diamine.
| Compound Name | 4-[(1S)-1-[3-(3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-ylmethyl)-4-methylphenyl]propyl]-1-N-ethyl-3-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 166852494 |
| Molecular Formula | C27H34N4OS |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 4-[(1S)-1-[3-(3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-ylmethyl)-4-methylphenyl]propyl]-1-N-ethyl-3-methylbenzene-1,2-diamine |
| SMILES | CCNc1ccc([C@@H](CC)c2ccc(C)c(CN3CCOc4ncccc4S3)c2)c(C)c1N |
| InChI | InChI=1S/C27H34N4OS/c1-5-22(23-11-12-24(29-6-2)26(28)19(23)4)20-10-9-18(3)21(16-20)17-31-14-15-32-27-25(33-31)8-7-13-30-27/h7-13,16,22,29H,5-6,14-15,17,28H2,1-4H3/t22-/m0/s1 |
| InChIKey | BDRMVHWVYOTFNF-QFIPXVFZSA-N |
| XLogP | 6.16 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|