C27H34N6O2S — CID 166852276
3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[3-(3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-ylmethyl)-4-methylphenyl]propanamide (PubChem CID 166852276) has the molecular formula C27H34N6O2S and a molecular weight of 506.68 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[3-(3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-ylmethyl)-4-methylphenyl]propanamide.
| Compound Name | 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[3-(3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-ylmethyl)-4-methylphenyl]propanamide |
|---|---|
| PubChem CID | 166852276 |
| Molecular Formula | C27H34N6O2S |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[3-(3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-ylmethyl)-4-methylphenyl]propanamide |
| SMILES | CCN(N)c1ccc(C(CC(N)=O)c2ccc(C)c(CN3CCOc4ncccc4S3)c2)c(C)c1N |
| InChI | InChI=1S/C27H34N6O2S/c1-4-33(30)23-10-9-21(18(3)26(23)29)22(15-25(28)34)19-8-7-17(2)20(14-19)16-32-12-13-35-27-24(36-32)6-5-11-31-27/h5-11,14,22H,4,12-13,15-16,29-30H2,1-3H3,(H2,28,34) |
| InChIKey | CNNLCQPPPQDRHF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|