C31H38N6O4S — CID 146412747
3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-3-[4-methyl-3-[[(11R)-8-oxo-13-oxa-8λ4-thia-1,3,9-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-9-yl]methyl]phenyl]propanoic acid (PubChem CID 146412747) has the molecular formula C31H38N6O4S and a molecular weight of 590.75 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-3-[4-methyl-3-[[(11R)-8-oxo-13-oxa-8λ4-thia-1,3,9-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-9-yl]methyl]phenyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-3-[4-methyl-3-[[(11R)-8-oxo-13-oxa-8λ4-thia-1,3,9-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-9-yl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 146412747 |
| Molecular Formula | C31H38N6O4S |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-3-[4-methyl-3-[[(11R)-8-oxo-13-oxa-8λ4-thia-1,3,9-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-9-yl]methyl]phenyl]propanoic acid |
| SMILES | Cc1ccc(C(CC(=O)O)c2ccc(N(N)C3CC3)c(N)c2C)cc1CN1C[C@@H]2COCCN2c2ncccc2S1=O |
| InChI | InChI=1S/C31H38N6O4S/c1-19-5-6-21(26(15-29(38)39)25-9-10-27(30(32)20(25)2)37(33)23-7-8-23)14-22(19)16-35-17-24-18-41-13-12-36(24)31-28(42(35)40)4-3-11-34-31/h3-6,9-11,14,23-24,26H,7-8,12-13,15-18,32-33H2,1-2H3,(H,38,39)/t24-,26?,42?/m1/s1 |
| InChIKey | MWSPIJBEBGOQTB-HELJVMDASA-N |
| XLogP | 3.47 |
| TPSA | 138.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|