C33H41N5O3S — CID 146413454
3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-3-[3-[[(7aS)-5-oxo-7,7a,8,9,10,11-hexahydropyrido[2,1-d][1,2,5]benzothiadiazepin-6-yl]methyl]-4-methylphenyl]propanoic acid (PubChem CID 146413454) has the molecular formula C33H41N5O3S and a molecular weight of 587.79 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-3-[3-[[(7aS)-5-oxo-7,7a,8,9,10,11-hexahydropyrido[2,1-d][1,2,5]benzothiadiazepin-6-yl]methyl]-4-methylphenyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-3-[3-[[(7aS)-5-oxo-7,7a,8,9,10,11-hexahydropyrido[2,1-d][1,2,5]benzothiadiazepin-6-yl]methyl]-4-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 146413454 |
| Molecular Formula | C33H41N5O3S |
| Molecular Weight | 587.79 g/mol |
| Exact Mass | 587.29 |
| IUPAC Name | 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-3-[3-[[(7aS)-5-oxo-7,7a,8,9,10,11-hexahydropyrido[2,1-d][1,2,5]benzothiadiazepin-6-yl]methyl]-4-methylphenyl]propanoic acid |
| SMILES | Cc1ccc(C(CC(=O)O)c2ccc(N(N)C3CC3)c(N)c2C)cc1CN1C[C@@H]2CCCCN2c2ccccc2S1=O |
| InChI | InChI=1S/C33H41N5O3S/c1-21-10-11-23(28(18-32(39)40)27-14-15-30(33(34)22(27)2)38(35)25-12-13-25)17-24(21)19-36-20-26-7-5-6-16-37(26)29-8-3-4-9-31(29)42(36)41/h3-4,8-11,14-15,17,25-26,28H,5-7,12-13,16,18-20,34-35H2,1-2H3,(H,39,40)/t26-,28?,42?/m0/s1 |
| InChIKey | YUYMCMYQBLFBRP-GTVNVDPISA-N |
| XLogP | 5.23 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.79 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|