C28H33FN4O3 — CID 155178737
3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(8-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)methyl]-4-methylphenyl]propanoic acid (PubChem CID 155178737) has the molecular formula C28H33FN4O3 and a molecular weight of 492.60 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(8-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)methyl]-4-methylphenyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(8-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)methyl]-4-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 155178737 |
| Molecular Formula | C28H33FN4O3 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(8-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)methyl]-4-methylphenyl]propanoic acid |
| SMILES | Cc1ccc(C(CC(=O)O)c2ccc(N(C)N)c(N)c2C)cc1CN1CCOc2cc(F)ccc2C1 |
| InChI | InChI=1S/C28H33FN4O3/c1-17-4-5-19(24(14-27(34)35)23-8-9-25(32(3)31)28(30)18(23)2)12-21(17)16-33-10-11-36-26-13-22(29)7-6-20(26)15-33/h4-9,12-13,24H,10-11,14-16,30-31H2,1-3H3,(H,34,35) |
| InChIKey | DLMMFWLEUMAYNS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|