C29H37N5O3 — CID 135142089
3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-(3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-ylmethyl)-4-methylphenyl]-2,2-dimethylpropanoic acid (PubChem CID 135142089) has the molecular formula C29H37N5O3 and a molecular weight of 503.65 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-(3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-ylmethyl)-4-methylphenyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-(3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-ylmethyl)-4-methylphenyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 135142089 |
| Molecular Formula | C29H37N5O3 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-(3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-ylmethyl)-4-methylphenyl]-2,2-dimethylpropanoic acid |
| SMILES | Cc1ccc(C(c2ccc(N(C)N)c(N)c2C)C(C)(C)C(=O)O)cc1CN1CCOc2ccncc2C1 |
| InChI | InChI=1S/C29H37N5O3/c1-18-6-7-20(14-21(18)16-34-12-13-37-25-10-11-32-15-22(25)17-34)26(29(3,4)28(35)36)23-8-9-24(33(5)31)27(30)19(23)2/h6-11,14-15,26H,12-13,16-17,30-31H2,1-5H3,(H,35,36) |
| InChIKey | HYMPSFPPKFXSLF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|