C34H41N7O4S — CID 166852437
3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-[3-[[(4R)-4-ethyl-1-oxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-N-(2-methoxypyrimidin-5-yl)propanamide (PubChem CID 166852437) has the molecular formula C34H41N7O4S and a molecular weight of 643.81 g/mol. Its IUPAC name is 3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-[3-[[(4R)-4-ethyl-1-oxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-N-(2-methoxypyrimidin-5-yl)propanamide.
| Compound Name | 3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-[3-[[(4R)-4-ethyl-1-oxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-N-(2-methoxypyrimidin-5-yl)propanamide |
|---|---|
| PubChem CID | 166852437 |
| Molecular Formula | C34H41N7O4S |
| Molecular Weight | 643.81 g/mol |
| Exact Mass | 643.29 |
| IUPAC Name | 3-[3-amino-4-(ethylamino)-2-methylphenyl]-3-[3-[[(4R)-4-ethyl-1-oxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-N-(2-methoxypyrimidin-5-yl)propanamide |
| SMILES | CCNc1ccc(C(CC(=O)Nc2cnc(OC)nc2)c2ccc(C)c(CN3C[C@@H](CC)Oc4ncccc4S3=O)c2)c(C)c1N |
| InChI | InChI=1S/C34H41N7O4S/c1-6-26-20-41(46(43)30-9-8-14-37-33(30)45-26)19-24-15-23(11-10-21(24)3)28(27-12-13-29(36-7-2)32(35)22(27)4)16-31(42)40-25-17-38-34(44-5)39-18-25/h8-15,17-18,26,28,36H,6-7,16,19-20,35H2,1-5H3,(H,40,42)/t26-,28?,46?/m1/s1 |
| InChIKey | ZWXPIPWZGKZVME-USJHDMQVSA-N |
| XLogP | 5.37 |
| TPSA | 144.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.81 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|