C22H31N3O2 — CID 142376286
ethyl 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-(3,4-dimethylphenyl)propanoate (PubChem CID 142376286) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is ethyl 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-(3,4-dimethylphenyl)propanoate.
| Compound Name | ethyl 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-(3,4-dimethylphenyl)propanoate |
|---|---|
| PubChem CID | 142376286 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | ethyl 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-(3,4-dimethylphenyl)propanoate |
| SMILES | CCOC(=O)CC(c1ccc(C)c(C)c1)c1ccc(N(N)CC)c(N)c1C |
| InChI | InChI=1S/C22H31N3O2/c1-6-25(24)20-11-10-18(16(5)22(20)23)19(13-21(26)27-7-2)17-9-8-14(3)15(4)12-17/h8-12,19H,6-7,13,23-24H2,1-5H3 |
| InChIKey | ZQBWZIQFLNLLAR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|