C28H34N5O4+ — CID 142408172
[7-[1-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-2-carboxyethyl]-2-benzoyl-3,4-dihydro-1H-isoquinolin-5-yl]-hydroxyazanium (PubChem CID 142408172) has the molecular formula C28H34N5O4+ and a molecular weight of 504.61 g/mol. Its IUPAC name is [7-[1-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-2-carboxyethyl]-2-benzoyl-3,4-dihydro-1H-isoquinolin-5-yl]-hydroxyazanium.
| Compound Name | [7-[1-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-2-carboxyethyl]-2-benzoyl-3,4-dihydro-1H-isoquinolin-5-yl]-hydroxyazanium |
|---|---|
| PubChem CID | 142408172 |
| Molecular Formula | C28H34N5O4+ |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | [7-[1-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-2-carboxyethyl]-2-benzoyl-3,4-dihydro-1H-isoquinolin-5-yl]-hydroxyazanium |
| SMILES | CCN(N)c1ccc(C(CC(=O)O)c2cc3c(c([NH2+]O)c2)CCN(C(=O)c2ccccc2)C3)c(C)c1N |
| InChI | InChI=1S/C28H33N5O4/c1-3-33(30)25-10-9-21(17(2)27(25)29)23(15-26(34)35)19-13-20-16-32(12-11-22(20)24(14-19)31-37)28(36)18-7-5-4-6-8-18/h4-10,13-14,23,31,37H,3,11-12,15-16,29-30H2,1-2H3,(H,34,35)/p+1 |
| InChIKey | WYADDSFACFUCEH-UHFFFAOYSA-O |
| XLogP | 2.67 |
| TPSA | 149.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|