C28H34N4O3 — CID 135275542
(4E,6E)-8-amino-7-[amino(ethyl)amino]-3-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-methylnona-4,6,8-trienoic acid (PubChem CID 135275542) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is (4E,6E)-8-amino-7-[amino(ethyl)amino]-3-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-methylnona-4,6,8-trienoic acid.
| Compound Name | (4E,6E)-8-amino-7-[amino(ethyl)amino]-3-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-methylnona-4,6,8-trienoic acid |
|---|---|
| PubChem CID | 135275542 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | (4E,6E)-8-amino-7-[amino(ethyl)amino]-3-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-4-methylnona-4,6,8-trienoic acid |
| SMILES | C=C(N)/C(=C\C=C(/C)C(CC(=O)O)c1ccc2c(c1)CN(C(=O)c1ccccc1)CC2)N(N)CC |
| InChI | InChI=1S/C28H34N4O3/c1-4-32(30)26(20(3)29)13-10-19(2)25(17-27(33)34)23-12-11-21-14-15-31(18-24(21)16-23)28(35)22-8-6-5-7-9-22/h5-13,16,25H,3-4,14-15,17-18,29-30H2,1-2H3,(H,33,34)/b19-10+,26-13+ |
| InChIKey | ZHIJCTWHGFBTFT-LQECEYKNSA-N |
| XLogP | 3.94 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|